C21H22N4O2 — CID 99641035
N-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 99641035) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | N-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 99641035 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]-3-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | COc1ccc2c(c1)CCC[C@H]2CNC(=O)c1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C21H22N4O2/c1-27-18-8-9-19-14(11-18)4-2-7-17(19)12-22-21(26)16-6-3-5-15(10-16)20-23-13-24-25-20/h3,5-6,8-11,13,17H,2,4,7,12H2,1H3,(H,22,26)(H,23,24,25)/t17-/m0/s1 |
| InChIKey | LSXQLUSJAWDURA-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |