C22H31N3O — CID 98895454
9-[[(1R)-cyclohex-3-en-1-yl]methyl]-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 98895454) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 9-[[(1R)-cyclohex-3-en-1-yl]methyl]-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 9-[[(1R)-cyclohex-3-en-1-yl]methyl]-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 98895454 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 9-[[(1R)-cyclohex-3-en-1-yl]methyl]-2-(pyridin-4-ylmethyl)-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C1N(Cc2ccncc2)CCCC12CCN(C[C@H]1CC=CCC1)CC2 |
| InChI | InChI=1S/C22H31N3O/c26-21-22(9-4-14-25(21)18-20-7-12-23-13-8-20)10-15-24(16-11-22)17-19-5-2-1-3-6-19/h1-2,7-8,12-13,19H,3-6,9-11,14-18H2/t19-/m0/s1 |
| InChIKey | RPKSMPGARQIXJB-IBGZPJMESA-N |
| XLogP | 3.64 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|