C16H23FN2O3S — CID 98895632
(4aS,8aS)-6-[(2-fluoro-5-methylphenyl)methyl]-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 98895632) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is (4aS,8aS)-6-[(2-fluoro-5-methylphenyl)methyl]-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | (4aS,8aS)-6-[(2-fluoro-5-methylphenyl)methyl]-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 98895632 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (4aS,8aS)-6-[(2-fluoro-5-methylphenyl)methyl]-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | Cc1ccc(F)c(CN2CC[C@@H]3OCCN(S(C)(=O)=O)[C@H]3C2)c1 |
| InChI | InChI=1S/C16H23FN2O3S/c1-12-3-4-14(17)13(9-12)10-18-6-5-16-15(11-18)19(7-8-22-16)23(2,20)21/h3-4,9,15-16H,5-8,10-11H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | KNTTVUCUVSRPNQ-HOTGVXAUSA-N |
| XLogP | 1.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |