C16H21FN2O2 — CID 98895812
(3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98895812) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is (3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98895812 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (3aR,6S,6aR)-4-[(2-fluorophenyl)methyl]-N,N-dimethyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CN(Cc2ccccc2F)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C16H21FN2O2/c1-18(2)16(20)12-10-19(14-7-8-21-15(12)14)9-11-5-3-4-6-13(11)17/h3-6,12,14-15H,7-10H2,1-2H3/t12-,14+,15+/m0/s1 |
| InChIKey | OTBUJYHYUUJLLE-NWANDNLSSA-N |
| XLogP | 1.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |