C17H26N4O3 — CID 97460361
3-[(3S,3aS,7aS)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea (PubChem CID 97460361) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-[(3S,3aS,7aS)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea.
| Compound Name | 3-[(3S,3aS,7aS)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 97460361 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-[(3S,3aS,7aS)-1-[(2-methoxy-3-pyridinyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea |
| SMILES | COc1ncccc1CN1C[C@H](NC(=O)N(C)C)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C17H26N4O3/c1-20(2)17(22)19-13-11-21(14-7-5-9-24-15(13)14)10-12-6-4-8-18-16(12)23-3/h4,6,8,13-15H,5,7,9-11H2,1-3H3,(H,19,22)/t13-,14-,15-/m0/s1 |
| InChIKey | GLLZVGDXRBALAT-KKUMJFAQSA-N |
| XLogP | 1.09 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |