C18H15Cl2N3O2S2 — CID 989907
N-(2,5-dichlorophenyl)-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 989907) has the molecular formula C18H15Cl2N3O2S2 and a molecular weight of 440.38 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 989907 |
| Molecular Formula | C18H15Cl2N3O2S2 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(6-methyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)ccc2Cl)nc2sc(C)cc2c1=O |
| InChI | InChI=1S/C18H15Cl2N3O2S2/c1-3-6-23-17(25)12-7-10(2)27-16(12)22-18(23)26-9-15(24)21-14-8-11(19)4-5-13(14)20/h3-5,7-8H,1,6,9H2,2H3,(H,21,24) |
| InChIKey | LYAVFZGLFLSUQF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|