C22H24ClN3O5 — CID 99087998
(2R)-N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide (PubChem CID 99087998) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is (2R)-N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 99087998 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (2R)-N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-1-(3-methyl-4-nitrobenzoyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1CN(C)C(=O)[C@H]1CCCN1C(=O)c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C22H24ClN3O5/c1-14-11-15(6-8-18(14)26(29)30)21(27)25-10-4-5-19(25)22(28)24(2)13-16-12-17(23)7-9-20(16)31-3/h6-9,11-12,19H,4-5,10,13H2,1-3H3/t19-/m1/s1 |
| InChIKey | VVENARZEZDXIQM-LJQANCHMSA-N |
| XLogP | 3.83 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|