C20H25NO4S — CID 990958
4-tert-butyl-N-[3-(1,3-dioxan-2-yl)phenyl]benzenesulfonamide (PubChem CID 990958) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(1,3-dioxan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-(1,3-dioxan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 990958 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-tert-butyl-N-[3-(1,3-dioxan-2-yl)phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2cccc(C3OCCCO3)c2)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-20(2,3)16-8-10-18(11-9-16)26(22,23)21-17-7-4-6-15(14-17)19-24-12-5-13-25-19/h4,6-11,14,19,21H,5,12-13H2,1-3H3 |
| InChIKey | XNFGDYCVOIUDTI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |