C17H15F3N2O2 — CID 99103887
(2S)-2-cyano-N-cyclopropyl-3-oxo-3-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide (PubChem CID 99103887) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is (2S)-2-cyano-N-cyclopropyl-3-oxo-3-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide.
| Compound Name | (2S)-2-cyano-N-cyclopropyl-3-oxo-3-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide |
|---|---|
| PubChem CID | 99103887 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S)-2-cyano-N-cyclopropyl-3-oxo-3-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide |
| SMILES | N#C[C@H](C(=O)NC1CC1)C(=O)[C@@H]1C[C@@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N2O2/c18-17(19,20)10-3-1-2-9(6-10)12-7-13(12)15(23)14(8-21)16(24)22-11-4-5-11/h1-3,6,11-14H,4-5,7H2,(H,22,24)/t12-,13-,14+/m1/s1 |
| InChIKey | SOACJDFEQJYOHK-MCIONIFRSA-N |
| XLogP | 2.80 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|