C14H10Cl4 — CID 99118733
1,2-dichloro-3-(2,2-dichloro-2-phenylethyl)benzene (PubChem CID 99118733) has the molecular formula C14H10Cl4 and a molecular weight of 320.05 g/mol. Its IUPAC name is 1,2-dichloro-3-(2,2-dichloro-2-phenylethyl)benzene.
| Compound Name | 1,2-dichloro-3-(2,2-dichloro-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 99118733 |
| Molecular Formula | C14H10Cl4 |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 1,2-dichloro-3-(2,2-dichloro-2-phenylethyl)benzene |
| SMILES | Clc1cccc(CC(Cl)(Cl)c2ccccc2)c1Cl |
| InChI | InChI=1S/C14H10Cl4/c15-12-8-4-5-10(13(12)16)9-14(17,18)11-6-2-1-3-7-11/h1-8H,9H2 |
| InChIKey | YAYSVTJKFDKJFP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|