C21H26ClNO3 — CID 99133250
(2R)-2-(4-chloro-3-methylphenoxy)-N-[(4-propan-2-yloxyphenyl)methyl]butanamide (PubChem CID 99133250) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-methylphenoxy)-N-[(4-propan-2-yloxyphenyl)methyl]butanamide.
| Compound Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[(4-propan-2-yloxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 99133250 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (2R)-2-(4-chloro-3-methylphenoxy)-N-[(4-propan-2-yloxyphenyl)methyl]butanamide |
| SMILES | CC[C@@H](Oc1ccc(Cl)c(C)c1)C(=O)NCc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C21H26ClNO3/c1-5-20(26-18-10-11-19(22)15(4)12-18)21(24)23-13-16-6-8-17(9-7-16)25-14(2)3/h6-12,14,20H,5,13H2,1-4H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | USZDLLYNZHWVLF-HXUWFJFHSA-N |
| XLogP | 4.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |