C21H26ClNO5 — CID 132663080
2-(4-chloro-3-methylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide (PubChem CID 132663080) has the molecular formula C21H26ClNO5 and a molecular weight of 407.89 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 132663080 |
| Molecular Formula | C21H26ClNO5 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
| SMILES | CCC(Oc1ccc(Cl)c(C)c1)C(=O)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H26ClNO5/c1-6-17(28-15-7-8-16(22)13(2)9-15)21(24)23-12-14-10-18(25-3)20(27-5)19(11-14)26-4/h7-11,17H,6,12H2,1-5H3,(H,23,24) |
| InChIKey | BJEMNNXFRKTQBL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |