C24H27NO2 — CID 991904
(4S)-1'-[(4-tert-butylphenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione (PubChem CID 991904) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (4S)-1'-[(4-tert-butylphenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione.
| Compound Name | (4S)-1'-[(4-tert-butylphenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 991904 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (4S)-1'-[(4-tert-butylphenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-2',5'-dione |
| SMILES | CC(C)(C)c1ccc(CN2C(=O)C[C@]3(CCCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C24H27NO2/c1-23(2,3)19-12-10-17(11-13-19)16-25-21(26)15-24(22(25)27)14-6-8-18-7-4-5-9-20(18)24/h4-5,7,9-13H,6,8,14-16H2,1-3H3/t24-/m0/s1 |
| InChIKey | VYXMARSFKBTTGY-DEOSSOPVSA-N |
| XLogP | 4.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|