C15H10Cl5NO2 — CID 991918
(2R,3S)-4,4,4-trichloro-1-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-3-ylbutan-1-one (PubChem CID 991918) has the molecular formula C15H10Cl5NO2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2R,3S)-4,4,4-trichloro-1-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-3-ylbutan-1-one.
| Compound Name | (2R,3S)-4,4,4-trichloro-1-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 991918 |
| Molecular Formula | C15H10Cl5NO2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | (2R,3S)-4,4,4-trichloro-1-(2,4-dichlorophenyl)-3-hydroxy-2-pyridin-3-ylbutan-1-one |
| SMILES | O=C(c1ccc(Cl)cc1Cl)[C@H](c1cccnc1)[C@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H10Cl5NO2/c16-9-3-4-10(11(17)6-9)13(22)12(14(23)15(18,19)20)8-2-1-5-21-7-8/h1-7,12,14,23H/t12-,14-/m0/s1 |
| InChIKey | RWHQUPKWBYNIJM-JSGCOSHPSA-N |
| XLogP | 5.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|