C19H13Cl2NO2 — CID 86157650
2-(2,4-dichlorophenoxy)-2-phenyl-1-pyridin-3-ylethanone (PubChem CID 86157650) has the molecular formula C19H13Cl2NO2 and a molecular weight of 358.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-2-phenyl-1-pyridin-3-ylethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-2-phenyl-1-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 86157650 |
| Molecular Formula | C19H13Cl2NO2 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-2-phenyl-1-pyridin-3-ylethanone |
| SMILES | O=C(c1cccnc1)C(Oc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H13Cl2NO2/c20-15-8-9-17(16(21)11-15)24-19(13-5-2-1-3-6-13)18(23)14-7-4-10-22-12-14/h1-12,19H |
| InChIKey | VQJXCNLWSGJWPV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |