C17H17Cl2NO3 — CID 19817142
[2-(2,4-dichlorophenoxy)-1-pyridin-3-ylbutyl] acetate (PubChem CID 19817142) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is [2-(2,4-dichlorophenoxy)-1-pyridin-3-ylbutyl] acetate.
| Compound Name | [2-(2,4-dichlorophenoxy)-1-pyridin-3-ylbutyl] acetate |
|---|---|
| PubChem CID | 19817142 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [2-(2,4-dichlorophenoxy)-1-pyridin-3-ylbutyl] acetate |
| SMILES | CCC(Oc1ccc(Cl)cc1Cl)C(OC(C)=O)c1cccnc1 |
| InChI | InChI=1S/C17H17Cl2NO3/c1-3-15(23-16-7-6-13(18)9-14(16)19)17(22-11(2)21)12-5-4-8-20-10-12/h4-10,15,17H,3H2,1-2H3 |
| InChIKey | PRUXJRACDRDIOA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |