C15H15BrN4O3S — CID 994540
methyl 4-[(4-bromo-1-ethylpyrazole-3-carbonyl)carbamothioylamino]benzoate (PubChem CID 994540) has the molecular formula C15H15BrN4O3S and a molecular weight of 411.28 g/mol. Its IUPAC name is methyl 4-[(4-bromo-1-ethylpyrazole-3-carbonyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-[(4-bromo-1-ethylpyrazole-3-carbonyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 994540 |
| Molecular Formula | C15H15BrN4O3S |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | methyl 4-[(4-bromo-1-ethylpyrazole-3-carbonyl)carbamothioylamino]benzoate |
| SMILES | CCn1cc(Br)c(C(=O)NC(=S)Nc2ccc(C(=O)OC)cc2)n1 |
| InChI | InChI=1S/C15H15BrN4O3S/c1-3-20-8-11(16)12(19-20)13(21)18-15(24)17-10-6-4-9(5-7-10)14(22)23-2/h4-8H,3H2,1-2H3,(H2,17,18,21,24) |
| InChIKey | ZFJAXQZXOUWQPC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|