C23H32O4 — CID 99568190
[(1R,2S,4S,6S,7S,10S,11R,14S)-4-acetyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate (PubChem CID 99568190) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(1R,2S,4S,6S,7S,10S,11R,14S)-4-acetyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate.
| Compound Name | [(1R,2S,4S,6S,7S,10S,11R,14S)-4-acetyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate |
|---|---|
| PubChem CID | 99568190 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(1R,2S,4S,6S,7S,10S,11R,14S)-4-acetyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-16-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4C[C@]5(C(C)=O)O[C@H]5[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H32O4/c1-13(24)23-12-19-17-6-5-15-11-16(26-14(2)25)7-9-21(15,3)18(17)8-10-22(19,4)20(23)27-23/h5,16-20H,6-12H2,1-4H3/t16-,17+,18-,19-,20-,21-,22-,23+/m0/s1 |
| InChIKey | GWZAVXCYXHGFFE-HIHPHDAESA-N |
| XLogP | 4.22 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|