C25H37O9P — CID 99568860
[2-[(3R,8R,9S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-3-phosphonooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 99568860) has the molecular formula C25H37O9P and a molecular weight of 512.54 g/mol. Its IUPAC name is [2-[(3R,8R,9S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-3-phosphonooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(3R,8R,9S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-3-phosphonooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 99568860 |
| Molecular Formula | C25H37O9P |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | [2-[(3R,8R,9S,10R,13S,14S,17R)-17-acetyloxy-10,13-dimethyl-3-phosphonooxy-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(OC(C)=O)CC[C@H]2[C@@H]3CC=C4C[C@H](OP(=O)(O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H37O9P/c1-15(26)32-14-22(28)25(33-16(2)27)12-9-21-19-6-5-17-13-18(34-35(29,30)31)7-10-23(17,3)20(19)8-11-24(21,25)4/h5,18-21H,6-14H2,1-4H3,(H2,29,30,31)/t18-,19-,20+,21+,23+,24+,25+/m1/s1 |
| InChIKey | RUEZRUSCFUKLOZ-DEUQAICHSA-N |
| XLogP | 3.86 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|