C19H26Br2O2 — CID 99571943
(2R,4S,5S,8S,9S,10R,13S,14S)-2,4-dibromo-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione (PubChem CID 99571943) has the molecular formula C19H26Br2O2 and a molecular weight of 446.22 g/mol. Its IUPAC name is (2R,4S,5S,8S,9S,10R,13S,14S)-2,4-dibromo-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | (2R,4S,5S,8S,9S,10R,13S,14S)-2,4-dibromo-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 99571943 |
| Molecular Formula | C19H26Br2O2 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (2R,4S,5S,8S,9S,10R,13S,14S)-2,4-dibromo-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC(=O)[C@H]3[C@H](Br)C(=O)[C@H](Br)C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H26Br2O2/c1-18-6-3-4-11(18)10-8-14(22)15-16(21)17(23)13(20)9-19(15,2)12(10)5-7-18/h10-13,15-16H,3-9H2,1-2H3/t10-,11-,12-,13+,15-,16-,18-,19+/m0/s1 |
| InChIKey | OQUKHIQVQFXNRS-MHVLCWHDSA-N |
| XLogP | 4.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|