C19H30O2 — CID 125027892
(5R,8S,9S,10S,13R,14R)-5-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 125027892) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (5R,8S,9S,10S,13R,14R)-5-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (5R,8S,9S,10S,13R,14R)-5-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 125027892 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (5R,8S,9S,10S,13R,14R)-5-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | C[C@]12CCC[C@@H]1[C@@H]1CC(=O)[C@@]3(O)CCCC[C@@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H30O2/c1-17-8-5-6-14(17)13-12-16(20)19(21)10-4-3-9-18(19,2)15(13)7-11-17/h13-15,21H,3-12H2,1-2H3/t13-,14+,15-,17+,18-,19-/m0/s1 |
| InChIKey | HHNSUTMKQLCOSH-YXIFDLGNSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |