C28H37N3O2S — CID 99572749
[(3E,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-(phenylcarbamothioylhydrazinylidene)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 99572749) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is [(3E,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-(phenylcarbamothioylhydrazinylidene)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3E,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-(phenylcarbamothioylhydrazinylidene)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 99572749 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | [(3E,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3-(phenylcarbamothioylhydrazinylidene)-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@H]2[C@@H]3CCC4=C/C(=N/NC(=S)Nc5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H37N3O2S/c1-18(32)33-25-12-11-23-22-10-9-19-17-21(30-31-26(34)29-20-7-5-4-6-8-20)13-15-27(19,2)24(22)14-16-28(23,25)3/h4-8,17,22-25H,9-16H2,1-3H3,(H2,29,31,34)/b30-21+/t22-,23-,24-,25+,27-,28-/m0/s1 |
| InChIKey | QXRBICYAQPNZOP-HWFYRLEWSA-N |
| XLogP | 6.22 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|