C26H32N2O6 — CID 99573030
1-[2-[(8S,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 99573030) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is 1-[2-[(8S,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[2-[(8S,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 99573030 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-[2-[(8S,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CC(=O)[C@]2(O)CC[C@H]3[C@@H]4CCC5=CC(=O)CC[C@]5(C)[C@H]4C(=O)C[C@@]32C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H32N2O6/c1-14-12-28(23(33)27-22(14)32)13-20(31)26(34)9-7-18-17-5-4-15-10-16(29)6-8-24(15,2)21(17)19(30)11-25(18,26)3/h10,12,17-18,21,34H,4-9,11,13H2,1-3H3,(H,27,32,33)/t17-,18-,21+,24-,25-,26+/m0/s1 |
| InChIKey | LFVRBRWYLPREJZ-QCXRVXIQSA-N |
| XLogP | 1.86 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'} |
|---|