C30H47NO2S — CID 99574700
[(3S,7R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-thiocyanato-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 99574700) has the molecular formula C30H47NO2S and a molecular weight of 485.78 g/mol. Its IUPAC name is [(3S,7R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-thiocyanato-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,7R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-thiocyanato-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 99574700 |
| Molecular Formula | C30H47NO2S |
| Molecular Weight | 485.78 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | [(3S,7R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-thiocyanato-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=C[C@H](SC#N)[C@H]3[C@@H]4CC[C@H]([C@@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H47NO2S/c1-19(2)8-7-9-20(3)24-10-11-25-28-26(13-15-30(24,25)6)29(5)14-12-23(33-21(4)32)16-22(29)17-27(28)34-18-31/h17,19-20,23-28H,7-16H2,1-6H3/t20-,23-,24+,25-,26-,27-,28-,29-,30+/m0/s1 |
| InChIKey | OZCSWRIJMBFXQD-ODTMJQNISA-N |
| XLogP | 8.15 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.78 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|