C20H30O3 — CID 99576205
(1S,2R,5R,7S,9S,11S,12S,15S,16S)-2,16-dimethylspiro[8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane-15,2'-oxirane]-5-ol (PubChem CID 99576205) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,2R,5R,7S,9S,11S,12S,15S,16S)-2,16-dimethylspiro[8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane-15,2'-oxirane]-5-ol.
| Compound Name | (1S,2R,5R,7S,9S,11S,12S,15S,16S)-2,16-dimethylspiro[8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane-15,2'-oxirane]-5-ol |
|---|---|
| PubChem CID | 99576205 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,2R,5R,7S,9S,11S,12S,15S,16S)-2,16-dimethylspiro[8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecane-15,2'-oxirane]-5-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](C[C@@H]4O[C@]45C[C@H](O)CC[C@]35C)[C@@H]1CC[C@@]21CO1 |
| InChI | InChI=1S/C20H30O3/c1-17-7-4-15-13(14(17)5-8-19(17)11-22-19)9-16-20(23-16)10-12(21)3-6-18(15,20)2/h12-16,21H,3-11H2,1-2H3/t12-,13+,14+,15+,16+,17+,18-,19-,20-/m1/s1 |
| InChIKey | GJTXTWKSFQDVKQ-REOZLEFCSA-N |
| XLogP | 3.29 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|