C24H38O3 — CID 59962593
(2R,16R)-2,16-dimethyl-15-[(2S)-1-[(2R)-oxiran-2-yl]propan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol (PubChem CID 59962593) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (2R,16R)-2,16-dimethyl-15-[(2S)-1-[(2R)-oxiran-2-yl]propan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol.
| Compound Name | (2R,16R)-2,16-dimethyl-15-[(2S)-1-[(2R)-oxiran-2-yl]propan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
|---|---|
| PubChem CID | 59962593 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (2R,16R)-2,16-dimethyl-15-[(2S)-1-[(2R)-oxiran-2-yl]propan-2-yl]-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
| SMILES | C[C@@H](C[C@@H]1CO1)C1CCC2C3CC4OC45CC(O)CC[C@]5(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H38O3/c1-14(10-16-13-26-16)18-4-5-19-17-11-21-24(27-21)12-15(25)6-9-23(24,3)20(17)7-8-22(18,19)2/h14-21,25H,4-13H2,1-3H3/t14-,15?,16+,17?,18?,19?,20?,21?,22+,23+,24?/m0/s1 |
| InChIKey | DXPZZHJEROYCJO-OKVDSLGFSA-N |
| XLogP | 4.56 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|