C27H47N3O3Si — CID 59910101
(2R,16R)-15-[(2S)-5-azido-4-trimethylsilyloxypentan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol (PubChem CID 59910101) has the molecular formula C27H47N3O3Si and a molecular weight of 489.78 g/mol. Its IUPAC name is (2R,16R)-15-[(2S)-5-azido-4-trimethylsilyloxypentan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol.
| Compound Name | (2R,16R)-15-[(2S)-5-azido-4-trimethylsilyloxypentan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
|---|---|
| PubChem CID | 59910101 |
| Molecular Formula | C27H47N3O3Si |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | (2R,16R)-15-[(2S)-5-azido-4-trimethylsilyloxypentan-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
| SMILES | C[C@@H](CC(CN=[N+]=[N-])O[Si](C)(C)C)C1CCC2C3CC4OC45CC(O)CC[C@]5(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H47N3O3Si/c1-17(13-19(16-29-30-28)33-34(4,5)6)21-7-8-22-20-14-24-27(32-24)15-18(31)9-12-26(27,3)23(20)10-11-25(21,22)2/h17-24,31H,7-16H2,1-6H3/t17-,18?,19?,20?,21?,22?,23?,24?,25+,26+,27?/m0/s1 |
| InChIKey | FMERNQDPKWFYLZ-AEUNSQJHSA-N |
| XLogP | 6.69 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|