C29H48O3 — CID 178022314
(2R,5S,16R)-15-[(2R)-5-hydroxy-5-propan-2-ylhept-6-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol (PubChem CID 178022314) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (2R,5S,16R)-15-[(2R)-5-hydroxy-5-propan-2-ylhept-6-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol.
| Compound Name | (2R,5S,16R)-15-[(2R)-5-hydroxy-5-propan-2-ylhept-6-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
|---|---|
| PubChem CID | 178022314 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (2R,5S,16R)-15-[(2R)-5-hydroxy-5-propan-2-ylhept-6-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-ol |
| SMILES | C=CC(O)(CC[C@@H](C)C1CCC2C3CC4OC45C[C@@H](O)CC[C@]5(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C29H48O3/c1-7-28(31,18(2)3)15-10-19(4)22-8-9-23-21-16-25-29(32-25)17-20(30)11-14-27(29,6)24(21)12-13-26(22,23)5/h7,18-25,30-31H,1,8-17H2,2-6H3/t19-,20+,21?,22?,23?,24?,25?,26-,27-,28?,29?/m1/s1 |
| InChIKey | LTNCVFRDLKMFLO-VDLCZSJQSA-N |
| XLogP | 6.13 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|