C16H22N2O5 — CID 99576981
4-hydroxy-N-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-3-nitrobenzamide (PubChem CID 99576981) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-hydroxy-N-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-hydroxy-N-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 99576981 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-hydroxy-N-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-3-nitrobenzamide |
| SMILES | CO[C@]1(C)C[C@H](N(C)C(=O)c2ccc(O)c([N+](=O)[O-])c2)C1(C)C |
| InChI | InChI=1S/C16H22N2O5/c1-15(2)13(9-16(15,3)23-5)17(4)14(20)10-6-7-12(19)11(8-10)18(21)22/h6-8,13,19H,9H2,1-5H3/t13-,16+/m0/s1 |
| InChIKey | GSEYNALJPIPKPN-XJKSGUPXSA-N |
| XLogP | 2.58 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|