C15H20N2O5 — CID 99717865
4-hydroxy-N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-nitrobenzamide (PubChem CID 99717865) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-hydroxy-N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-nitrobenzamide.
| Compound Name | 4-hydroxy-N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 99717865 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-hydroxy-N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-nitrobenzamide |
| SMILES | CO[C@@]1(C)C[C@H](NC(=O)c2ccc(O)c([N+](=O)[O-])c2)C1(C)C |
| InChI | InChI=1S/C15H20N2O5/c1-14(2)12(8-15(14,3)22-4)16-13(19)9-5-6-11(18)10(7-9)17(20)21/h5-7,12,18H,8H2,1-4H3,(H,16,19)/t12-,15-/m0/s1 |
| InChIKey | GDGNMLOGJWVZFL-WFASDCNBSA-N |
| XLogP | 2.23 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|