C16H22N2O5 — CID 99695661
N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-hydroxy-4-nitrobenzamide (PubChem CID 99695661) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-hydroxy-4-nitrobenzamide.
| Compound Name | N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-hydroxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 99695661 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-hydroxy-4-nitrobenzamide |
| SMILES | CCC1(CC)[C@H](NC(=O)c2ccc([N+](=O)[O-])c(O)c2)C[C@H]1OC |
| InChI | InChI=1S/C16H22N2O5/c1-4-16(5-2)13(9-14(16)23-3)17-15(20)10-6-7-11(18(21)22)12(19)8-10/h6-8,13-14,19H,4-5,9H2,1-3H3,(H,17,20)/t13-,14-/m1/s1 |
| InChIKey | ZVCWORXDBSWQQF-ZIAGYGMSSA-N |
| XLogP | 2.62 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|