C16H25ClN2O2 — CID 119821933
3-amino-N-(2,2-diethyl-3-methoxycyclobutyl)benzamide;hydrochloride (PubChem CID 119821933) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 3-amino-N-(2,2-diethyl-3-methoxycyclobutyl)benzamide;hydrochloride.
| Compound Name | 3-amino-N-(2,2-diethyl-3-methoxycyclobutyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119821933 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-amino-N-(2,2-diethyl-3-methoxycyclobutyl)benzamide;hydrochloride |
| SMILES | CCC1(CC)C(NC(=O)c2cccc(N)c2)CC1OC.Cl |
| InChI | InChI=1S/C16H24N2O2.ClH/c1-4-16(5-2)13(10-14(16)20-3)18-15(19)11-7-6-8-12(17)9-11;/h6-9,13-14H,4-5,10,17H2,1-3H3,(H,18,19);1H |
| InChIKey | VEJKDVLVLJGBFW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|