C23H30IN7 — CID 9958681
Mdl-106327DA (PubChem CID 9958681) has the molecular formula C23H30IN7 and a molecular weight of 531.40 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[(3-iodophenyl)methyl]purine-2,6-diamine.
| Compound Name | Mdl-106327DA |
|---|---|
| PubChem CID | 9958681 |
| Molecular Formula | C23H30IN7 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-[(3-iodophenyl)methyl]purine-2,6-diamine |
| SMILES | C1CCC(C1)N2C=NC3=C(N=C(N=C32)NC4CCC(CC4)N)NCC5=CC(=CC=C5)I |
| InChI | InChI=1S/C23H30IN7/c24-16-5-3-4-15(12-16)13-26-21-20-22(31(14-27-20)19-6-1-2-7-19)30-23(29-21)28-18-10-8-17(25)9-11-18/h3-5,12,14,17-19H,1-2,6-11,13,25H2,(H2,26,28,29,30) |
| InChIKey | SCAGLYMBBLMFND-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | 566 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|