C17H29NO2S — CID 99596257
2-(4-tert-butylcyclohexylidene)-N-[[(3R)-3-hydroxythiolan-3-yl]methyl]acetamide (PubChem CID 99596257) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexylidene)-N-[[(3R)-3-hydroxythiolan-3-yl]methyl]acetamide.
| Compound Name | 2-(4-tert-butylcyclohexylidene)-N-[[(3R)-3-hydroxythiolan-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 99596257 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-(4-tert-butylcyclohexylidene)-N-[[(3R)-3-hydroxythiolan-3-yl]methyl]acetamide |
| SMILES | CC(C)(C)C1CCC(=CC(=O)NC[C@]2(O)CCSC2)CC1 |
| InChI | InChI=1S/C17H29NO2S/c1-16(2,3)14-6-4-13(5-7-14)10-15(19)18-11-17(20)8-9-21-12-17/h10,14,20H,4-9,11-12H2,1-3H3,(H,18,19)/b13-10-/t14?,17-/m1/s1 |
| InChIKey | WPRBHVPWQQSZNF-KPFUOMFPSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|