C18H17FN2O2 — CID 99620226
[3-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-pyridinyl]methanol (PubChem CID 99620226) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is [3-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-pyridinyl]methanol.
| Compound Name | [3-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 99620226 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [3-[[5-(4-fluoro-2-methylphenyl)furan-2-yl]methylamino]-4-pyridinyl]methanol |
| SMILES | Cc1cc(F)ccc1-c1ccc(CNc2cnccc2CO)o1 |
| InChI | InChI=1S/C18H17FN2O2/c1-12-8-14(19)2-4-16(12)18-5-3-15(23-18)9-21-17-10-20-7-6-13(17)11-22/h2-8,10,21-22H,9,11H2,1H3 |
| InChIKey | SAYRRMMBENJYPI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |