C20H26N4O — CID 99620500
cyclopentyl-[(3R)-3-[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]pyrrolidin-1-yl]methanone (PubChem CID 99620500) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is cyclopentyl-[(3R)-3-[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]pyrrolidin-1-yl]methanone.
| Compound Name | cyclopentyl-[(3R)-3-[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 99620500 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | cyclopentyl-[(3R)-3-[[(S)-1H-imidazol-2-yl(phenyl)methyl]amino]pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CC[C@@H](N[C@@H](c2ccccc2)c2ncc[nH]2)C1 |
| InChI | InChI=1S/C20H26N4O/c25-20(16-8-4-5-9-16)24-13-10-17(14-24)23-18(19-21-11-12-22-19)15-6-2-1-3-7-15/h1-3,6-7,11-12,16-18,23H,4-5,8-10,13-14H2,(H,21,22)/t17-,18+/m1/s1 |
| InChIKey | DAQYMCUVPWFQFG-MSOLQXFVSA-N |
| XLogP | 2.88 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |