C18H22FNO2 — CID 99621655
(1R,3S)-3-[[3-(2-fluorophenyl)cyclobutyl]amino]-1-(furan-2-yl)butan-1-ol (PubChem CID 99621655) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is (1R,3S)-3-[[3-(2-fluorophenyl)cyclobutyl]amino]-1-(furan-2-yl)butan-1-ol.
| Compound Name | (1R,3S)-3-[[3-(2-fluorophenyl)cyclobutyl]amino]-1-(furan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 99621655 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (1R,3S)-3-[[3-(2-fluorophenyl)cyclobutyl]amino]-1-(furan-2-yl)butan-1-ol |
| SMILES | C[C@@H](C[C@@H](O)c1ccco1)NC1CC(c2ccccc2F)C1 |
| InChI | InChI=1S/C18H22FNO2/c1-12(9-17(21)18-7-4-8-22-18)20-14-10-13(11-14)15-5-2-3-6-16(15)19/h2-8,12-14,17,20-21H,9-11H2,1H3/t12-,13?,14?,17+/m0/s1 |
| InChIKey | CWTVOXZOTDZFIR-VBRUCIBASA-N |
| XLogP | 3.77 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |