C15H17NO2S2 — CID 99630865
N-[2-[[(S)-methylsulfinyl]methyl]phenyl]-3-thiophen-2-ylpropanamide (PubChem CID 99630865) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[2-[[(S)-methylsulfinyl]methyl]phenyl]-3-thiophen-2-ylpropanamide.
| Compound Name | N-[2-[[(S)-methylsulfinyl]methyl]phenyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 99630865 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | N-[2-[[(S)-methylsulfinyl]methyl]phenyl]-3-thiophen-2-ylpropanamide |
| SMILES | C[S@](=O)Cc1ccccc1NC(=O)CCc1cccs1 |
| InChI | InChI=1S/C15H17NO2S2/c1-20(18)11-12-5-2-3-7-14(12)16-15(17)9-8-13-6-4-10-19-13/h2-7,10H,8-9,11H2,1H3,(H,16,17)/t20-/m0/s1 |
| InChIKey | WREWNGXETZQVKJ-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |