C17H12ClF2N3O3 — CID 99630944
6-chloro-N-[[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 99630944) has the molecular formula C17H12ClF2N3O3 and a molecular weight of 379.75 g/mol. Its IUPAC name is 6-chloro-N-[[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-chloro-N-[[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 99630944 |
| Molecular Formula | C17H12ClF2N3O3 |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 6-chloro-N-[[3-(3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Fc1ccc(-c2noc(CNc3cc4c(cc3Cl)OCCO4)n2)cc1F |
| InChI | InChI=1S/C17H12ClF2N3O3/c18-10-6-14-15(25-4-3-24-14)7-13(10)21-8-16-22-17(23-26-16)9-1-2-11(19)12(20)5-9/h1-2,5-7,21H,3-4,8H2 |
| InChIKey | OLDLKQMHUQYGCF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|