About 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine
5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine (PubChem CID 99631936) has the molecular formula C13H16BrN5
and a molecular weight of 322.21 g/mol. Its IUPAC name is 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine |
| PubChem CID | 99631936 |
| Molecular Formula | C13H16BrN5 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(N(C)[C@@H](C)c2ccccn2)ncc1Br |
| InChI | InChI=1S/C13H16BrN5/c1-9(11-6-4-5-7-16-11)19(3)13-17-8-10(14)12(15-2)18-13/h4-9H,1-3H3,(H,15,17,18)/t9-/m0/s1 |
| InChIKey | NRPXAKORANOWIV-VIFPVBQESA-N |
| XLogP | 2.87 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine (CID 99631936) is 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine is CNc1nc(N(C)[C@@H](C)c2ccccn2)ncc1Br.
What is the InChIKey of 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine?
The InChIKey is NRPXAKORANOWIV-VIFPVBQESA-N. The full InChI is InChI=1S/C13H16BrN5/c1-9(11-6-4-5-7-16-11)19(3)13-17-8-10(14)12(15-2)18-13/h4-9H,1-3H3,(H,15,17,18)/t9-/m0/s1.
What are the key properties of 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine?
5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine has a molecular weight of 322.21 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-N,4-N-dimethyl-2-N-[(1S)-1-pyridin-2-ylethyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 99631936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).