About N-methylmethanamine;1-pyridin-2-ylethanamine
N-methylmethanamine;1-pyridin-2-ylethanamine (PubChem CID 143812006) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is N-methylmethanamine;1-pyridin-2-ylethanamine.
Molecular Properties
| Compound Name | N-methylmethanamine;1-pyridin-2-ylethanamine |
| PubChem CID | 143812006 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N-methylmethanamine;1-pyridin-2-ylethanamine |
| SMILES | CC(N)c1ccccn1.CNC |
| InChI | InChI=1S/C7H10N2.C2H7N/c1-6(8)7-4-2-3-5-9-7;1-3-2/h2-6H,8H2,1H3;3H,1-2H3 |
| InChIKey | AAEURAJIAVAVPP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylmethanamine;1-pyridin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;1-pyridin-2-ylethanamine?
The IUPAC name of N-methylmethanamine;1-pyridin-2-ylethanamine (CID 143812006) is N-methylmethanamine;1-pyridin-2-ylethanamine.
What is the SMILES notation for N-methylmethanamine;1-pyridin-2-ylethanamine?
The canonical SMILES for N-methylmethanamine;1-pyridin-2-ylethanamine is CC(N)c1ccccn1.CNC.
What is the InChIKey of N-methylmethanamine;1-pyridin-2-ylethanamine?
The InChIKey is AAEURAJIAVAVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H7N/c1-6(8)7-4-2-3-5-9-7;1-3-2/h2-6H,8H2,1H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;1-pyridin-2-ylethanamine?
N-methylmethanamine;1-pyridin-2-ylethanamine has a molecular weight of 167.26 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;1-pyridin-2-ylethanamine is sourced from PubChem (CID 143812006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).