About pyridine;1-pyridin-2-ylethanamine
pyridine;1-pyridin-2-ylethanamine (PubChem CID 159737903) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is pyridine;1-pyridin-2-ylethanamine.
Molecular Properties
| Compound Name | pyridine;1-pyridin-2-ylethanamine |
| PubChem CID | 159737903 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | pyridine;1-pyridin-2-ylethanamine |
| SMILES | CC(N)c1ccccn1.c1ccncc1 |
| InChI | InChI=1S/C7H10N2.C5H5N/c1-6(8)7-4-2-3-5-9-7;1-2-4-6-5-3-1/h2-6H,8H2,1H3;1-5H |
| InChIKey | NCBLTXQCAWZXAV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine;1-pyridin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;1-pyridin-2-ylethanamine?
The IUPAC name of pyridine;1-pyridin-2-ylethanamine (CID 159737903) is pyridine;1-pyridin-2-ylethanamine.
What is the SMILES notation for pyridine;1-pyridin-2-ylethanamine?
The canonical SMILES for pyridine;1-pyridin-2-ylethanamine is CC(N)c1ccccn1.c1ccncc1.
What is the InChIKey of pyridine;1-pyridin-2-ylethanamine?
The InChIKey is NCBLTXQCAWZXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C5H5N/c1-6(8)7-4-2-3-5-9-7;1-2-4-6-5-3-1/h2-6H,8H2,1H3;1-5H.
What are the key properties of pyridine;1-pyridin-2-ylethanamine?
pyridine;1-pyridin-2-ylethanamine has a molecular weight of 201.27 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;1-pyridin-2-ylethanamine is sourced from PubChem (CID 159737903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).