C17H21ClN4OS — CID 99633428
(E)-3-(2-chlorophenyl)-2-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]prop-2-enamide (PubChem CID 99633428) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-2-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-2-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 99633428 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-2-methyl-N-[2-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
| SMILES | C/C(=C\c1ccccc1Cl)C(=O)NCCc1n[nH]c(=S)n1C(C)C |
| InChI | InChI=1S/C17H21ClN4OS/c1-11(2)22-15(20-21-17(22)24)8-9-19-16(23)12(3)10-13-6-4-5-7-14(13)18/h4-7,10-11H,8-9H2,1-3H3,(H,19,23)(H,21,24)/b12-10+ |
| InChIKey | XBZGZTBDVIIYAT-ZRDIBKRKSA-N |
| XLogP | 3.94 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|