C19H19N3O4S — CID 99636278
4-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 99636278) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 99636278 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1c2c3c(sc2ncn1C[C@H](O)c1cccc([N+](=O)[O-])c1)CCCCC3 |
| InChI | InChI=1S/C19H19N3O4S/c23-15(12-5-4-6-13(9-12)22(25)26)10-21-11-20-18-17(19(21)24)14-7-2-1-3-8-16(14)27-18/h4-6,9,11,15,23H,1-3,7-8,10H2/t15-/m0/s1 |
| InChIKey | PKKJDFSSYRKWIG-HNNXBMFYSA-N |
| XLogP | 3.37 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|