C20H30FN3O — CID 99642062
2-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone (PubChem CID 99642062) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 2-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99642062 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 2-[4-[2-(2-fluorophenyl)ethyl]piperazin-1-yl]-1-[(2R)-2-methylpiperidin-1-yl]ethanone |
| SMILES | C[C@@H]1CCCCN1C(=O)CN1CCN(CCc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H30FN3O/c1-17-6-4-5-10-24(17)20(25)16-23-14-12-22(13-15-23)11-9-18-7-2-3-8-19(18)21/h2-3,7-8,17H,4-6,9-16H2,1H3/t17-/m1/s1 |
| InChIKey | YUEVSNPWJIAXBH-QGZVFWFLSA-N |
| XLogP | 2.39 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |