C38H34N6O2S3 — CID 99651965
(2R)-2-[[4-methyl-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]propanamide (PubChem CID 99651965) has the molecular formula C38H34N6O2S3 and a molecular weight of 702.93 g/mol. Its IUPAC name is (2R)-2-[[4-methyl-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]propanamide.
| Compound Name | (2R)-2-[[4-methyl-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]propanamide |
|---|---|
| PubChem CID | 99651965 |
| Molecular Formula | C38H34N6O2S3 |
| Molecular Weight | 702.93 g/mol |
| Exact Mass | 702.19 |
| IUPAC Name | (2R)-2-[[4-methyl-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]propanamide |
| SMILES | C[C@@H](Sc1nnc(Cc2cccc3ccccc23)n1C)C(=O)Nc1ccc2nc(SCC(=O)n3c4c(c5ccccc53)CCCC4)sc2c1 |
| InChI | InChI=1S/C38H34N6O2S3/c1-23(48-37-42-41-34(43(37)2)20-25-12-9-11-24-10-3-4-13-27(24)25)36(46)39-26-18-19-30-33(21-26)49-38(40-30)47-22-35(45)44-31-16-7-5-14-28(31)29-15-6-8-17-32(29)44/h3-5,7,9-14,16,18-19,21,23H,6,8,15,17,20,22H2,1-2H3,(H,39,46)/t23-/m1/s1 |
| InChIKey | ULVKJRZYLHNOIZ-HSZRJFAPSA-N |
| XLogP | 8.55 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.93 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |