C30H24N4O2S4 — CID 21208701
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide (PubChem CID 21208701) has the molecular formula C30H24N4O2S4 and a molecular weight of 600.82 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 21208701 |
| Molecular Formula | C30H24N4O2S4 |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)Nc1ccc2nc(SCC(=O)n3c4c(c5ccccc53)CCCC4)sc2c1 |
| InChI | InChI=1S/C30H24N4O2S4/c35-27(16-37-29-32-21-9-3-6-12-25(21)39-29)31-18-13-14-22-26(15-18)40-30(33-22)38-17-28(36)34-23-10-4-1-7-19(23)20-8-2-5-11-24(20)34/h1,3-4,6-7,9-10,12-15H,2,5,8,11,16-17H2,(H,31,35) |
| InChIKey | YGBLEXMLUHXMMU-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |