C32H26Cl2N6O2S2 — CID 99668472
(1S,2R)-1,2-bis[5-[(2-chlorophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]ethane-1,2-diol (PubChem CID 99668472) has the molecular formula C32H26Cl2N6O2S2 and a molecular weight of 661.64 g/mol. Its IUPAC name is (1S,2R)-1,2-bis[5-[(2-chlorophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]ethane-1,2-diol.
| Compound Name | (1S,2R)-1,2-bis[5-[(2-chlorophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 99668472 |
| Molecular Formula | C32H26Cl2N6O2S2 |
| Molecular Weight | 661.64 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | (1S,2R)-1,2-bis[5-[(2-chlorophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]ethane-1,2-diol |
| SMILES | O[C@H](c1nnc(SCc2ccccc2Cl)n1-c1ccccc1)[C@@H](O)c1nnc(SCc2ccccc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C32H26Cl2N6O2S2/c33-25-17-9-7-11-21(25)19-43-31-37-35-29(39(31)23-13-3-1-4-14-23)27(41)28(42)30-36-38-32(40(30)24-15-5-2-6-16-24)44-20-22-12-8-10-18-26(22)34/h1-18,27-28,41-42H,19-20H2/t27-,28+ |
| InChIKey | HDZTVQZLCUFHFX-HNRBIFIRSA-N |
| XLogP | 7.51 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.64 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |