C31H32BrN3O7 — CID 99669884
N-[(Z)-1-(5-bromo-2-methoxyphenyl)-3-oxo-3-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 99669884) has the molecular formula C31H32BrN3O7 and a molecular weight of 638.52 g/mol. Its IUPAC name is N-[(Z)-1-(5-bromo-2-methoxyphenyl)-3-oxo-3-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-1-(5-bromo-2-methoxyphenyl)-3-oxo-3-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 99669884 |
| Molecular Formula | C31H32BrN3O7 |
| Molecular Weight | 638.52 g/mol |
| Exact Mass | 637.14 |
| IUPAC Name | N-[(Z)-1-(5-bromo-2-methoxyphenyl)-3-oxo-3-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]prop-1-en-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(Br)cc1/C=C(\NC(=O)c1cc(OC)c(OC)c(OC)c1)C(=O)N1C[C@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C31H32BrN3O7/c1-39-25-9-8-22(32)11-19(25)12-23(33-30(37)20-13-26(40-2)29(42-4)27(14-20)41-3)31(38)34-15-18-10-21(17-34)24-6-5-7-28(36)35(24)16-18/h5-9,11-14,18,21H,10,15-17H2,1-4H3,(H,33,37)/b23-12-/t18-,21-/m1/s1 |
| InChIKey | RCGYVBHBUSJGJD-TWAOSMCASA-N |
| XLogP | 4.06 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|