C30H37N3O6 — CID 92694938
N-[(E)-3-oxo-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]cyclohexanecarboxamide (PubChem CID 92694938) has the molecular formula C30H37N3O6 and a molecular weight of 535.64 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(E)-3-oxo-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 92694938 |
| Molecular Formula | C30H37N3O6 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | N-[(E)-3-oxo-3-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]cyclohexanecarboxamide |
| SMILES | COc1cc(/C=C(/NC(=O)C2CCCCC2)C(=O)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc(OC)c1OC |
| InChI | InChI=1S/C30H37N3O6/c1-37-25-14-19(15-26(38-2)28(25)39-3)13-23(31-29(35)21-8-5-4-6-9-21)30(36)32-16-20-12-22(18-32)24-10-7-11-27(34)33(24)17-20/h7,10-11,13-15,20-22H,4-6,8-9,12,16-18H2,1-3H3,(H,31,35)/b23-13+/t20-,22+/m1/s1 |
| InChIKey | VMNCNWIVQFVYOA-MBIGCVILSA-N |
| XLogP | 3.56 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|